C23H18N6O — CID 122421692
(E)-2-cyano-3-[3-[3-[5-(methylamino)-3-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enamide (PubChem CID 122421692) has the molecular formula C23H18N6O and a molecular weight of 394.44 g/mol. Its IUPAC name is (E)-2-cyano-3-[3-[3-[5-(methylamino)-3-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[3-[3-[5-(methylamino)-3-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122421692 |
| Molecular Formula | C23H18N6O |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | (E)-2-cyano-3-[3-[3-[5-(methylamino)-3-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enamide |
| SMILES | CNc1cncc(-c2c[nH]c3ncc(-c4cccc(/C=C(\C#N)C(N)=O)c4)cc23)c1 |
| InChI | InChI=1S/C23H18N6O/c1-26-19-7-18(10-27-12-19)21-13-29-23-20(21)8-17(11-28-23)15-4-2-3-14(5-15)6-16(9-24)22(25)30/h2-8,10-13,26H,1H3,(H2,25,30)(H,28,29)/b16-6+ |
| InChIKey | DHSONHVHWUDUNL-OMCISZLKSA-N |
| XLogP | 3.73 |
| TPSA | 120.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|