C25H22N6O — CID 135237798
(E)-N-[5-[3-(3-cyanophenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-3-pyridinyl]-4-(dimethylamino)but-2-enamide (PubChem CID 135237798) has the molecular formula C25H22N6O and a molecular weight of 422.49 g/mol. Its IUPAC name is (E)-N-[5-[3-(3-cyanophenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-3-pyridinyl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[5-[3-(3-cyanophenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-3-pyridinyl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 135237798 |
| Molecular Formula | C25H22N6O |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | (E)-N-[5-[3-(3-cyanophenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-3-pyridinyl]-4-(dimethylamino)but-2-enamide |
| SMILES | CN(C)C/C=C/C(=O)Nc1cncc(-c2cnc3[nH]cc(-c4cccc(C#N)c4)c3c2)c1 |
| InChI | InChI=1S/C25H22N6O/c1-31(2)8-4-7-24(32)30-21-10-19(13-27-15-21)20-11-22-23(16-29-25(22)28-14-20)18-6-3-5-17(9-18)12-26/h3-7,9-11,13-16H,8H2,1-2H3,(H,28,29)(H,30,32)/b7-4+ |
| InChIKey | FYDJMPXXMCPINQ-QPJJXVBHSA-N |
| XLogP | 4.22 |
| TPSA | 97.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|