C20H21N5O3 — CID 122553730
[3-[2-[[(E)-4-(dimethylamino)but-2-enoyl]amino]phenyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]carbamic acid (PubChem CID 122553730) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is [3-[2-[[(E)-4-(dimethylamino)but-2-enoyl]amino]phenyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]carbamic acid.
| Compound Name | [3-[2-[[(E)-4-(dimethylamino)but-2-enoyl]amino]phenyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]carbamic acid |
|---|---|
| PubChem CID | 122553730 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | [3-[2-[[(E)-4-(dimethylamino)but-2-enoyl]amino]phenyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]carbamic acid |
| SMILES | CN(C)C/C=C/C(=O)Nc1ccccc1-c1c[nH]c2ncc(NC(=O)O)cc12 |
| InChI | InChI=1S/C20H21N5O3/c1-25(2)9-5-8-18(26)24-17-7-4-3-6-14(17)16-12-22-19-15(16)10-13(11-21-19)23-20(27)28/h3-8,10-12,23H,9H2,1-2H3,(H,21,22)(H,24,26)(H,27,28)/b8-5+ |
| InChIKey | VMDIXODSRYSOFF-VMPITWQZSA-N |
| XLogP | 3.38 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|