C24H19N5O2 — CID 135238208
N-[5-[3-(3-cyanophenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-2-ethoxy-3-pyridinyl]prop-2-enamide (PubChem CID 135238208) has the molecular formula C24H19N5O2 and a molecular weight of 409.45 g/mol. Its IUPAC name is N-[5-[3-(3-cyanophenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-2-ethoxy-3-pyridinyl]prop-2-enamide.
| Compound Name | N-[5-[3-(3-cyanophenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-2-ethoxy-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 135238208 |
| Molecular Formula | C24H19N5O2 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | N-[5-[3-(3-cyanophenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-2-ethoxy-3-pyridinyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(-c2cnc3[nH]cc(-c4cccc(C#N)c4)c3c2)cnc1OCC |
| InChI | InChI=1S/C24H19N5O2/c1-3-22(30)29-21-10-18(13-28-24(21)31-4-2)17-9-19-20(14-27-23(19)26-12-17)16-7-5-6-15(8-16)11-25/h3,5-10,12-14H,1,4H2,2H3,(H,26,27)(H,29,30) |
| InChIKey | SEHMIZRBBJBWPR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|