C27H25N4O5P — CID 135238139
1-[3-(3-cyanophenyl)-5-[3-(prop-2-enoylamino)phenyl]pyrrolo[2,3-b]pyridin-1-yl]ethyl ethyl hydrogen phosphate (PubChem CID 135238139) has the molecular formula C27H25N4O5P and a molecular weight of 516.49 g/mol. Its IUPAC name is 1-[3-(3-cyanophenyl)-5-[3-(prop-2-enoylamino)phenyl]pyrrolo[2,3-b]pyridin-1-yl]ethyl ethyl hydrogen phosphate.
| Compound Name | 1-[3-(3-cyanophenyl)-5-[3-(prop-2-enoylamino)phenyl]pyrrolo[2,3-b]pyridin-1-yl]ethyl ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 135238139 |
| Molecular Formula | C27H25N4O5P |
| Molecular Weight | 516.49 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | 1-[3-(3-cyanophenyl)-5-[3-(prop-2-enoylamino)phenyl]pyrrolo[2,3-b]pyridin-1-yl]ethyl ethyl hydrogen phosphate |
| SMILES | C=CC(=O)Nc1cccc(-c2cnc3c(c2)c(-c2cccc(C#N)c2)cn3C(C)OP(=O)(O)OCC)c1 |
| InChI | InChI=1S/C27H25N4O5P/c1-4-26(32)30-23-11-7-9-20(13-23)22-14-24-25(21-10-6-8-19(12-21)15-28)17-31(27(24)29-16-22)18(3)36-37(33,34)35-5-2/h4,6-14,16-18H,1,5H2,2-3H3,(H,30,32)(H,33,34) |
| InChIKey | KEIIICLRCQTTKD-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 126.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.49 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|