C29H30N5O5P — CID 135238460
1-[3-(3-cyanophenyl)-5-[5-[methyl(prop-2-enoyl)amino]-3-pyridinyl]pyrrolo[2,3-b]pyridin-1-yl]ethyl diethyl phosphate (PubChem CID 135238460) has the molecular formula C29H30N5O5P and a molecular weight of 559.56 g/mol. Its IUPAC name is 1-[3-(3-cyanophenyl)-5-[5-[methyl(prop-2-enoyl)amino]-3-pyridinyl]pyrrolo[2,3-b]pyridin-1-yl]ethyl diethyl phosphate.
| Compound Name | 1-[3-(3-cyanophenyl)-5-[5-[methyl(prop-2-enoyl)amino]-3-pyridinyl]pyrrolo[2,3-b]pyridin-1-yl]ethyl diethyl phosphate |
|---|---|
| PubChem CID | 135238460 |
| Molecular Formula | C29H30N5O5P |
| Molecular Weight | 559.56 g/mol |
| Exact Mass | 559.20 |
| IUPAC Name | 1-[3-(3-cyanophenyl)-5-[5-[methyl(prop-2-enoyl)amino]-3-pyridinyl]pyrrolo[2,3-b]pyridin-1-yl]ethyl diethyl phosphate |
| SMILES | C=CC(=O)N(C)c1cncc(-c2cnc3c(c2)c(-c2cccc(C#N)c2)cn3C(C)OP(=O)(OCC)OCC)c1 |
| InChI | InChI=1S/C29H30N5O5P/c1-6-28(35)33(5)25-13-23(16-31-18-25)24-14-26-27(22-11-9-10-21(12-22)15-30)19-34(29(26)32-17-24)20(4)39-40(36,37-7-2)38-8-3/h6,9-14,16-20H,1,7-8H2,2-5H3 |
| InChIKey | OYVJQVYWJPGOCC-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 119.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.56 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|