C27H30FN6O5P — CID 135237673
[5-[5-[[(E)-4-(dimethylamino)but-2-enoyl]-methylamino]-3-pyridinyl]-3-(2-fluoro-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]methyl ethyl hydrogen phosphate (PubChem CID 135237673) has the molecular formula C27H30FN6O5P and a molecular weight of 568.55 g/mol. Its IUPAC name is [5-[5-[[(E)-4-(dimethylamino)but-2-enoyl]-methylamino]-3-pyridinyl]-3-(2-fluoro-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]methyl ethyl hydrogen phosphate.
| Compound Name | [5-[5-[[(E)-4-(dimethylamino)but-2-enoyl]-methylamino]-3-pyridinyl]-3-(2-fluoro-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]methyl ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 135237673 |
| Molecular Formula | C27H30FN6O5P |
| Molecular Weight | 568.55 g/mol |
| Exact Mass | 568.20 |
| IUPAC Name | [5-[5-[[(E)-4-(dimethylamino)but-2-enoyl]-methylamino]-3-pyridinyl]-3-(2-fluoro-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]methyl ethyl hydrogen phosphate |
| SMILES | CCOP(=O)(O)OCn1cc(-c2ccnc(F)c2)c2cc(-c3cncc(N(C)C(=O)/C=C/CN(C)C)c3)cnc21 |
| InChI | InChI=1S/C27H30FN6O5P/c1-5-38-40(36,37)39-18-34-17-24(19-8-9-30-25(28)13-19)23-12-21(15-31-27(23)34)20-11-22(16-29-14-20)33(4)26(35)7-6-10-32(2)3/h6-9,11-17H,5,10,18H2,1-4H3,(H,36,37)/b7-6+ |
| InChIKey | YRDARUFDBUQCQS-VOTSOKGWSA-N |
| XLogP | 4.49 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|