C26H28FN6O5P — CID 135237566
[5-[5-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-3-pyridinyl]-3-(2-fluoro-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]methyl ethyl hydrogen phosphate (PubChem CID 135237566) has the molecular formula C26H28FN6O5P and a molecular weight of 554.52 g/mol. Its IUPAC name is [5-[5-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-3-pyridinyl]-3-(2-fluoro-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]methyl ethyl hydrogen phosphate.
| Compound Name | [5-[5-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-3-pyridinyl]-3-(2-fluoro-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]methyl ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 135237566 |
| Molecular Formula | C26H28FN6O5P |
| Molecular Weight | 554.52 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | [5-[5-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-3-pyridinyl]-3-(2-fluoro-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]methyl ethyl hydrogen phosphate |
| SMILES | CCOP(=O)(O)OCn1cc(-c2ccnc(F)c2)c2cc(-c3cncc(NC(=O)/C=C/CN(C)C)c3)cnc21 |
| InChI | InChI=1S/C26H28FN6O5P/c1-4-37-39(35,36)38-17-33-16-23(18-7-8-29-24(27)12-18)22-11-20(14-30-26(22)33)19-10-21(15-28-13-19)31-25(34)6-5-9-32(2)3/h5-8,10-16H,4,9,17H2,1-3H3,(H,31,34)(H,35,36)/b6-5+ |
| InChIKey | CWFRCNYICNRQAU-AATRIKPKSA-N |
| XLogP | 4.47 |
| TPSA | 131.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|