C30H36FN6O5P — CID 135237581
1-[5-[5-[4-(dimethylamino)but-2-enoyl-methylamino]-3-pyridinyl]-3-(2-fluoro-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]ethyl diethyl phosphate (PubChem CID 135237581) has the molecular formula C30H36FN6O5P and a molecular weight of 610.63 g/mol. Its IUPAC name is 1-[5-[5-[4-(dimethylamino)but-2-enoyl-methylamino]-3-pyridinyl]-3-(2-fluoro-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]ethyl diethyl phosphate.
| Compound Name | 1-[5-[5-[4-(dimethylamino)but-2-enoyl-methylamino]-3-pyridinyl]-3-(2-fluoro-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]ethyl diethyl phosphate |
|---|---|
| PubChem CID | 135237581 |
| Molecular Formula | C30H36FN6O5P |
| Molecular Weight | 610.63 g/mol |
| Exact Mass | 610.25 |
| IUPAC Name | 1-[5-[5-[4-(dimethylamino)but-2-enoyl-methylamino]-3-pyridinyl]-3-(2-fluoro-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]ethyl diethyl phosphate |
| SMILES | CCOP(=O)(OCC)OC(C)n1cc(-c2ccnc(F)c2)c2cc(-c3cncc(N(C)C(=O)C=CCN(C)C)c3)cnc21 |
| InChI | InChI=1S/C30H36FN6O5P/c1-7-40-43(39,41-8-2)42-21(3)37-20-27(22-11-12-33-28(31)16-22)26-15-24(18-34-30(26)37)23-14-25(19-32-17-23)36(6)29(38)10-9-13-35(4)5/h9-12,14-21H,7-8,13H2,1-6H3 |
| InChIKey | HLTJCHIZGNDSGS-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 111.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.63 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|