C32H37FN6O3 — CID 135237663
1-[5-[3-[[(E)-4-(dimethylamino)but-2-enoyl]amino]phenyl]-3-(2-fluoro-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]ethyl 2-amino-3-methylpentanoate (PubChem CID 135237663) has the molecular formula C32H37FN6O3 and a molecular weight of 572.69 g/mol. Its IUPAC name is 1-[5-[3-[[(E)-4-(dimethylamino)but-2-enoyl]amino]phenyl]-3-(2-fluoro-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]ethyl 2-amino-3-methylpentanoate.
| Compound Name | 1-[5-[3-[[(E)-4-(dimethylamino)but-2-enoyl]amino]phenyl]-3-(2-fluoro-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]ethyl 2-amino-3-methylpentanoate |
|---|---|
| PubChem CID | 135237663 |
| Molecular Formula | C32H37FN6O3 |
| Molecular Weight | 572.69 g/mol |
| Exact Mass | 572.29 |
| IUPAC Name | 1-[5-[3-[[(E)-4-(dimethylamino)but-2-enoyl]amino]phenyl]-3-(2-fluoro-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]ethyl 2-amino-3-methylpentanoate |
| SMILES | CCC(C)C(N)C(=O)OC(C)n1cc(-c2ccnc(F)c2)c2cc(-c3cccc(NC(=O)/C=C/CN(C)C)c3)cnc21 |
| InChI | InChI=1S/C32H37FN6O3/c1-6-20(2)30(34)32(41)42-21(3)39-19-27(23-12-13-35-28(33)17-23)26-16-24(18-36-31(26)39)22-9-7-10-25(15-22)37-29(40)11-8-14-38(4)5/h7-13,15-21,30H,6,14,34H2,1-5H3,(H,37,40)/b11-8+ |
| InChIKey | WLMIIXRJWMAGLL-DHZHZOJOSA-N |
| XLogP | 5.40 |
| TPSA | 115.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.69 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|