C30H32FN5O4 — CID 135238406
1-[3-(2-fluoro-4-pyridinyl)-5-[3-methoxy-5-(prop-2-enoylamino)phenyl]pyrrolo[2,3-b]pyridin-1-yl]ethyl (2S,3S)-2-amino-3-methylpentanoate (PubChem CID 135238406) has the molecular formula C30H32FN5O4 and a molecular weight of 545.62 g/mol. Its IUPAC name is 1-[3-(2-fluoro-4-pyridinyl)-5-[3-methoxy-5-(prop-2-enoylamino)phenyl]pyrrolo[2,3-b]pyridin-1-yl]ethyl (2S,3S)-2-amino-3-methylpentanoate.
| Compound Name | 1-[3-(2-fluoro-4-pyridinyl)-5-[3-methoxy-5-(prop-2-enoylamino)phenyl]pyrrolo[2,3-b]pyridin-1-yl]ethyl (2S,3S)-2-amino-3-methylpentanoate |
|---|---|
| PubChem CID | 135238406 |
| Molecular Formula | C30H32FN5O4 |
| Molecular Weight | 545.62 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | 1-[3-(2-fluoro-4-pyridinyl)-5-[3-methoxy-5-(prop-2-enoylamino)phenyl]pyrrolo[2,3-b]pyridin-1-yl]ethyl (2S,3S)-2-amino-3-methylpentanoate |
| SMILES | C=CC(=O)Nc1cc(OC)cc(-c2cnc3c(c2)c(-c2ccnc(F)c2)cn3C(C)OC(=O)[C@@H](N)[C@@H](C)CC)c1 |
| InChI | InChI=1S/C30H32FN5O4/c1-6-17(3)28(32)30(38)40-18(4)36-16-25(19-8-9-33-26(31)13-19)24-12-21(15-34-29(24)36)20-10-22(35-27(37)7-2)14-23(11-20)39-5/h7-18,28H,2,6,32H2,1,3-5H3,(H,35,37)/t17-,18?,28-/m0/s1 |
| InChIKey | DALIIFNKRIBCSP-VQLCAWSVSA-N |
| XLogP | 5.47 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.62 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|