C27H27FN6O3 — CID 135237722
[3-(2-fluoro-4-pyridinyl)-5-[5-(prop-2-enoylamino)-3-pyridinyl]pyrrolo[2,3-b]pyridin-1-yl]methyl 2-amino-4-methylpentanoate (PubChem CID 135237722) has the molecular formula C27H27FN6O3 and a molecular weight of 502.55 g/mol. Its IUPAC name is [3-(2-fluoro-4-pyridinyl)-5-[5-(prop-2-enoylamino)-3-pyridinyl]pyrrolo[2,3-b]pyridin-1-yl]methyl 2-amino-4-methylpentanoate.
| Compound Name | [3-(2-fluoro-4-pyridinyl)-5-[5-(prop-2-enoylamino)-3-pyridinyl]pyrrolo[2,3-b]pyridin-1-yl]methyl 2-amino-4-methylpentanoate |
|---|---|
| PubChem CID | 135237722 |
| Molecular Formula | C27H27FN6O3 |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | [3-(2-fluoro-4-pyridinyl)-5-[5-(prop-2-enoylamino)-3-pyridinyl]pyrrolo[2,3-b]pyridin-1-yl]methyl 2-amino-4-methylpentanoate |
| SMILES | C=CC(=O)Nc1cncc(-c2cnc3c(c2)c(-c2ccnc(F)c2)cn3COC(=O)C(N)CC(C)C)c1 |
| InChI | InChI=1S/C27H27FN6O3/c1-4-25(35)33-20-8-18(11-30-13-20)19-9-21-22(17-5-6-31-24(28)10-17)14-34(26(21)32-12-19)15-37-27(36)23(29)7-16(2)3/h4-6,8-14,16,23H,1,7,15,29H2,2-3H3,(H,33,35) |
| InChIKey | XQBFKFCZTCMMGB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 125.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|