C24H18N6O3 — CID 135238198
[3-(2-cyano-4-pyridinyl)-5-[5-(prop-2-enoylamino)-3-pyridinyl]pyrrolo[2,3-b]pyridin-1-yl]methyl acetate (PubChem CID 135238198) has the molecular formula C24H18N6O3 and a molecular weight of 438.45 g/mol. Its IUPAC name is [3-(2-cyano-4-pyridinyl)-5-[5-(prop-2-enoylamino)-3-pyridinyl]pyrrolo[2,3-b]pyridin-1-yl]methyl acetate.
| Compound Name | [3-(2-cyano-4-pyridinyl)-5-[5-(prop-2-enoylamino)-3-pyridinyl]pyrrolo[2,3-b]pyridin-1-yl]methyl acetate |
|---|---|
| PubChem CID | 135238198 |
| Molecular Formula | C24H18N6O3 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | [3-(2-cyano-4-pyridinyl)-5-[5-(prop-2-enoylamino)-3-pyridinyl]pyrrolo[2,3-b]pyridin-1-yl]methyl acetate |
| SMILES | C=CC(=O)Nc1cncc(-c2cnc3c(c2)c(-c2ccnc(C#N)c2)cn3COC(C)=O)c1 |
| InChI | InChI=1S/C24H18N6O3/c1-3-23(32)29-20-7-17(10-26-12-20)18-8-21-22(16-4-5-27-19(6-16)9-25)13-30(14-33-15(2)31)24(21)28-11-18/h3-8,10-13H,1,14H2,2H3,(H,29,32) |
| InChIKey | PKFAAQRWTVTWHY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 122.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|