C31H34N5O5P — CID 135238121
ditert-butyl [3-(2-cyano-4-pyridinyl)-5-[3-(prop-2-enoylamino)phenyl]pyrrolo[2,3-b]pyridin-1-yl]methyl phosphate (PubChem CID 135238121) has the molecular formula C31H34N5O5P and a molecular weight of 587.62 g/mol. Its IUPAC name is ditert-butyl [3-(2-cyano-4-pyridinyl)-5-[3-(prop-2-enoylamino)phenyl]pyrrolo[2,3-b]pyridin-1-yl]methyl phosphate.
| Compound Name | ditert-butyl [3-(2-cyano-4-pyridinyl)-5-[3-(prop-2-enoylamino)phenyl]pyrrolo[2,3-b]pyridin-1-yl]methyl phosphate |
|---|---|
| PubChem CID | 135238121 |
| Molecular Formula | C31H34N5O5P |
| Molecular Weight | 587.62 g/mol |
| Exact Mass | 587.23 |
| IUPAC Name | ditert-butyl [3-(2-cyano-4-pyridinyl)-5-[3-(prop-2-enoylamino)phenyl]pyrrolo[2,3-b]pyridin-1-yl]methyl phosphate |
| SMILES | C=CC(=O)Nc1cccc(-c2cnc3c(c2)c(-c2ccnc(C#N)c2)cn3COP(=O)(OC(C)(C)C)OC(C)(C)C)c1 |
| InChI | InChI=1S/C31H34N5O5P/c1-8-28(37)35-24-11-9-10-21(14-24)23-16-26-27(22-12-13-33-25(15-22)17-32)19-36(29(26)34-18-23)20-39-42(38,40-30(2,3)4)41-31(5,6)7/h8-16,18-19H,1,20H2,2-7H3,(H,35,37) |
| InChIKey | YMVZTVBGDVIDBJ-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.62 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|