C22H20N5O6P — CID 135238049
[3-(2-methoxy-4-pyridinyl)-5-[5-(prop-2-enoylamino)-3-pyridinyl]pyrrolo[2,3-b]pyridin-1-yl]methyl dihydrogen phosphate (PubChem CID 135238049) has the molecular formula C22H20N5O6P and a molecular weight of 481.41 g/mol. Its IUPAC name is [3-(2-methoxy-4-pyridinyl)-5-[5-(prop-2-enoylamino)-3-pyridinyl]pyrrolo[2,3-b]pyridin-1-yl]methyl dihydrogen phosphate.
| Compound Name | [3-(2-methoxy-4-pyridinyl)-5-[5-(prop-2-enoylamino)-3-pyridinyl]pyrrolo[2,3-b]pyridin-1-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 135238049 |
| Molecular Formula | C22H20N5O6P |
| Molecular Weight | 481.41 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | [3-(2-methoxy-4-pyridinyl)-5-[5-(prop-2-enoylamino)-3-pyridinyl]pyrrolo[2,3-b]pyridin-1-yl]methyl dihydrogen phosphate |
| SMILES | C=CC(=O)Nc1cncc(-c2cnc3c(c2)c(-c2ccnc(OC)c2)cn3COP(=O)(O)O)c1 |
| InChI | InChI=1S/C22H20N5O6P/c1-3-20(28)26-17-6-15(9-23-11-17)16-7-18-19(14-4-5-24-21(8-14)32-2)12-27(22(18)25-10-16)13-33-34(29,30)31/h3-12H,1,13H2,2H3,(H,26,28)(H2,29,30,31) |
| InChIKey | AAVIAEQPWFXGIO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 148.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|