C29H33N4O7P — CID 135238240
tert-butyl 1-[5-[3-methoxy-5-(prop-2-enoylamino)phenyl]-3-(2-methoxy-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]ethyl hydrogen phosphate (PubChem CID 135238240) has the molecular formula C29H33N4O7P and a molecular weight of 580.58 g/mol. Its IUPAC name is tert-butyl 1-[5-[3-methoxy-5-(prop-2-enoylamino)phenyl]-3-(2-methoxy-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]ethyl hydrogen phosphate.
| Compound Name | tert-butyl 1-[5-[3-methoxy-5-(prop-2-enoylamino)phenyl]-3-(2-methoxy-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 135238240 |
| Molecular Formula | C29H33N4O7P |
| Molecular Weight | 580.58 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | tert-butyl 1-[5-[3-methoxy-5-(prop-2-enoylamino)phenyl]-3-(2-methoxy-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]ethyl hydrogen phosphate |
| SMILES | C=CC(=O)Nc1cc(OC)cc(-c2cnc3c(c2)c(-c2ccnc(OC)c2)cn3C(C)OP(=O)(O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C29H33N4O7P/c1-8-26(34)32-22-11-20(12-23(15-22)37-6)21-13-24-25(19-9-10-30-27(14-19)38-7)17-33(28(24)31-16-21)18(2)39-41(35,36)40-29(3,4)5/h8-18H,1H2,2-7H3,(H,32,34)(H,35,36) |
| InChIKey | ZTCOQKYZVOOWJV-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 134.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.58 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|