C26H27N4O7P — CID 135238507
1-[5-[3-methoxy-5-[methyl(prop-2-enoyl)amino]phenyl]-3-(2-methoxy-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]ethyl dihydrogen phosphate (PubChem CID 135238507) has the molecular formula C26H27N4O7P and a molecular weight of 538.50 g/mol. Its IUPAC name is 1-[5-[3-methoxy-5-[methyl(prop-2-enoyl)amino]phenyl]-3-(2-methoxy-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]ethyl dihydrogen phosphate.
| Compound Name | 1-[5-[3-methoxy-5-[methyl(prop-2-enoyl)amino]phenyl]-3-(2-methoxy-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 135238507 |
| Molecular Formula | C26H27N4O7P |
| Molecular Weight | 538.50 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | 1-[5-[3-methoxy-5-[methyl(prop-2-enoyl)amino]phenyl]-3-(2-methoxy-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]ethyl dihydrogen phosphate |
| SMILES | C=CC(=O)N(C)c1cc(OC)cc(-c2cnc3c(c2)c(-c2ccnc(OC)c2)cn3C(C)OP(=O)(O)O)c1 |
| InChI | InChI=1S/C26H27N4O7P/c1-6-25(31)29(3)20-9-18(10-21(13-20)35-4)19-11-22-23(17-7-8-27-24(12-17)36-5)15-30(26(22)28-14-19)16(2)37-38(32,33)34/h6-16H,1H2,2-5H3,(H2,32,33,34) |
| InChIKey | FAUDYHVTNSBMFV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 136.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|