C23H20FN4O6P — CID 135238127
[3-(2-fluoro-4-pyridinyl)-5-[3-methoxy-5-(prop-2-enoylamino)phenyl]pyrrolo[2,3-b]pyridin-1-yl]methyl dihydrogen phosphate (PubChem CID 135238127) has the molecular formula C23H20FN4O6P and a molecular weight of 498.41 g/mol. Its IUPAC name is [3-(2-fluoro-4-pyridinyl)-5-[3-methoxy-5-(prop-2-enoylamino)phenyl]pyrrolo[2,3-b]pyridin-1-yl]methyl dihydrogen phosphate.
| Compound Name | [3-(2-fluoro-4-pyridinyl)-5-[3-methoxy-5-(prop-2-enoylamino)phenyl]pyrrolo[2,3-b]pyridin-1-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 135238127 |
| Molecular Formula | C23H20FN4O6P |
| Molecular Weight | 498.41 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | [3-(2-fluoro-4-pyridinyl)-5-[3-methoxy-5-(prop-2-enoylamino)phenyl]pyrrolo[2,3-b]pyridin-1-yl]methyl dihydrogen phosphate |
| SMILES | C=CC(=O)Nc1cc(OC)cc(-c2cnc3c(c2)c(-c2ccnc(F)c2)cn3COP(=O)(O)O)c1 |
| InChI | InChI=1S/C23H20FN4O6P/c1-3-22(29)27-17-6-15(7-18(10-17)33-2)16-8-19-20(14-4-5-25-21(24)9-14)12-28(23(19)26-11-16)13-34-35(30,31)32/h3-12H,1,13H2,2H3,(H,27,29)(H2,30,31,32) |
| InChIKey | PEZPHTPCDCYWDF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 135.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|