C27H28FN4O6P — CID 135238355
diethyl [3-(2-fluoro-4-pyridinyl)-5-[3-methoxy-5-(prop-2-enoylamino)phenyl]pyrrolo[2,3-b]pyridin-1-yl]methyl phosphate (PubChem CID 135238355) has the molecular formula C27H28FN4O6P and a molecular weight of 554.52 g/mol. Its IUPAC name is diethyl [3-(2-fluoro-4-pyridinyl)-5-[3-methoxy-5-(prop-2-enoylamino)phenyl]pyrrolo[2,3-b]pyridin-1-yl]methyl phosphate.
| Compound Name | diethyl [3-(2-fluoro-4-pyridinyl)-5-[3-methoxy-5-(prop-2-enoylamino)phenyl]pyrrolo[2,3-b]pyridin-1-yl]methyl phosphate |
|---|---|
| PubChem CID | 135238355 |
| Molecular Formula | C27H28FN4O6P |
| Molecular Weight | 554.52 g/mol |
| Exact Mass | 554.17 |
| IUPAC Name | diethyl [3-(2-fluoro-4-pyridinyl)-5-[3-methoxy-5-(prop-2-enoylamino)phenyl]pyrrolo[2,3-b]pyridin-1-yl]methyl phosphate |
| SMILES | C=CC(=O)Nc1cc(OC)cc(-c2cnc3c(c2)c(-c2ccnc(F)c2)cn3COP(=O)(OCC)OCC)c1 |
| InChI | InChI=1S/C27H28FN4O6P/c1-5-26(33)31-21-10-19(11-22(14-21)35-4)20-12-23-24(18-8-9-29-25(28)13-18)16-32(27(23)30-15-20)17-38-39(34,36-6-2)37-7-3/h5,8-16H,1,6-7,17H2,2-4H3,(H,31,33) |
| InChIKey | USLBLFLGAJWDLB-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 113.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.52 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|