C29H34FN6O5P — CID 135238202
[5-[5-[[(E)-4-(dimethylamino)but-2-enoyl]-methylamino]-3-pyridinyl]-3-(2-fluoro-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]methyl diethyl phosphate (PubChem CID 135238202) has the molecular formula C29H34FN6O5P and a molecular weight of 596.60 g/mol. Its IUPAC name is [5-[5-[[(E)-4-(dimethylamino)but-2-enoyl]-methylamino]-3-pyridinyl]-3-(2-fluoro-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]methyl diethyl phosphate.
| Compound Name | [5-[5-[[(E)-4-(dimethylamino)but-2-enoyl]-methylamino]-3-pyridinyl]-3-(2-fluoro-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]methyl diethyl phosphate |
|---|---|
| PubChem CID | 135238202 |
| Molecular Formula | C29H34FN6O5P |
| Molecular Weight | 596.60 g/mol |
| Exact Mass | 596.23 |
| IUPAC Name | [5-[5-[[(E)-4-(dimethylamino)but-2-enoyl]-methylamino]-3-pyridinyl]-3-(2-fluoro-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]methyl diethyl phosphate |
| SMILES | CCOP(=O)(OCC)OCn1cc(-c2ccnc(F)c2)c2cc(-c3cncc(N(C)C(=O)/C=C/CN(C)C)c3)cnc21 |
| InChI | InChI=1S/C29H34FN6O5P/c1-6-39-42(38,40-7-2)41-20-36-19-26(21-10-11-32-27(30)15-21)25-14-23(17-33-29(25)36)22-13-24(18-31-16-22)35(5)28(37)9-8-12-34(3)4/h8-11,13-19H,6-7,12,20H2,1-5H3/b9-8+ |
| InChIKey | AJAKJNQKVKSSRP-CMDGGOBGSA-N |
| XLogP | 5.54 |
| TPSA | 111.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.60 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|