C30H34FN7O3 — CID 135238177
[5-[5-[4-(dimethylamino)but-2-enoylamino]-3-pyridinyl]-3-(2-fluoro-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]methyl 2-amino-4-methylpentanoate (PubChem CID 135238177) has the molecular formula C30H34FN7O3 and a molecular weight of 559.65 g/mol. Its IUPAC name is [5-[5-[4-(dimethylamino)but-2-enoylamino]-3-pyridinyl]-3-(2-fluoro-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]methyl 2-amino-4-methylpentanoate.
| Compound Name | [5-[5-[4-(dimethylamino)but-2-enoylamino]-3-pyridinyl]-3-(2-fluoro-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]methyl 2-amino-4-methylpentanoate |
|---|---|
| PubChem CID | 135238177 |
| Molecular Formula | C30H34FN7O3 |
| Molecular Weight | 559.65 g/mol |
| Exact Mass | 559.27 |
| IUPAC Name | [5-[5-[4-(dimethylamino)but-2-enoylamino]-3-pyridinyl]-3-(2-fluoro-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]methyl 2-amino-4-methylpentanoate |
| SMILES | CC(C)CC(N)C(=O)OCn1cc(-c2ccnc(F)c2)c2cc(-c3cncc(NC(=O)C=CCN(C)C)c3)cnc21 |
| InChI | InChI=1S/C30H34FN7O3/c1-19(2)10-26(32)30(40)41-18-38-17-25(20-7-8-34-27(31)13-20)24-12-22(15-35-29(24)38)21-11-23(16-33-14-21)36-28(39)6-5-9-37(3)4/h5-8,11-17,19,26H,9-10,18,32H2,1-4H3,(H,36,39) |
| InChIKey | VGMBXSHVLDGBRG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 128.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.65 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|