C32H37FN6O4 — CID 135237488
[5-[3-[4-(dimethylamino)but-2-enoylamino]-5-methoxyphenyl]-3-(2-fluoro-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]methyl 2-amino-4-methylpentanoate (PubChem CID 135237488) has the molecular formula C32H37FN6O4 and a molecular weight of 588.68 g/mol. Its IUPAC name is [5-[3-[4-(dimethylamino)but-2-enoylamino]-5-methoxyphenyl]-3-(2-fluoro-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]methyl 2-amino-4-methylpentanoate.
| Compound Name | [5-[3-[4-(dimethylamino)but-2-enoylamino]-5-methoxyphenyl]-3-(2-fluoro-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]methyl 2-amino-4-methylpentanoate |
|---|---|
| PubChem CID | 135237488 |
| Molecular Formula | C32H37FN6O4 |
| Molecular Weight | 588.68 g/mol |
| Exact Mass | 588.29 |
| IUPAC Name | [5-[3-[4-(dimethylamino)but-2-enoylamino]-5-methoxyphenyl]-3-(2-fluoro-4-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]methyl 2-amino-4-methylpentanoate |
| SMILES | COc1cc(NC(=O)C=CCN(C)C)cc(-c2cnc3c(c2)c(-c2ccnc(F)c2)cn3COC(=O)C(N)CC(C)C)c1 |
| InChI | InChI=1S/C32H37FN6O4/c1-20(2)11-28(34)32(41)43-19-39-18-27(21-8-9-35-29(33)15-21)26-14-23(17-36-31(26)39)22-12-24(16-25(13-22)42-5)37-30(40)7-6-10-38(3)4/h6-9,12-18,20,28H,10-11,19,34H2,1-5H3,(H,37,40) |
| InChIKey | OHCNQPNOXKJYOJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.68 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|