C28H28N5O6P — CID 135237843
[3-(3-cyanophenyl)-5-[3-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-5-methoxyphenyl]pyrrolo[2,3-b]pyridin-1-yl]methyl dihydrogen phosphate (PubChem CID 135237843) has the molecular formula C28H28N5O6P and a molecular weight of 561.54 g/mol. Its IUPAC name is [3-(3-cyanophenyl)-5-[3-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-5-methoxyphenyl]pyrrolo[2,3-b]pyridin-1-yl]methyl dihydrogen phosphate.
| Compound Name | [3-(3-cyanophenyl)-5-[3-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-5-methoxyphenyl]pyrrolo[2,3-b]pyridin-1-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 135237843 |
| Molecular Formula | C28H28N5O6P |
| Molecular Weight | 561.54 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | [3-(3-cyanophenyl)-5-[3-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-5-methoxyphenyl]pyrrolo[2,3-b]pyridin-1-yl]methyl dihydrogen phosphate |
| SMILES | COc1cc(NC(=O)/C=C/CN(C)C)cc(-c2cnc3c(c2)c(-c2cccc(C#N)c2)cn3COP(=O)(O)O)c1 |
| InChI | InChI=1S/C28H28N5O6P/c1-32(2)9-5-8-27(34)31-23-11-21(12-24(14-23)38-3)22-13-25-26(20-7-4-6-19(10-20)15-29)17-33(28(25)30-16-22)18-39-40(35,36)37/h4-8,10-14,16-17H,9,18H2,1-3H3,(H,31,34)(H2,35,36,37)/b8-5+ |
| InChIKey | MJTJWKNDDXZWBU-VMPITWQZSA-N |
| XLogP | 4.37 |
| TPSA | 149.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|