C26H24N5O6P — CID 135238231
[3-(2-cyano-4-pyridinyl)-5-[3-methoxy-5-(prop-2-enoylamino)phenyl]pyrrolo[2,3-b]pyridin-1-yl]methyl ethyl hydrogen phosphate (PubChem CID 135238231) has the molecular formula C26H24N5O6P and a molecular weight of 533.48 g/mol. Its IUPAC name is [3-(2-cyano-4-pyridinyl)-5-[3-methoxy-5-(prop-2-enoylamino)phenyl]pyrrolo[2,3-b]pyridin-1-yl]methyl ethyl hydrogen phosphate.
| Compound Name | [3-(2-cyano-4-pyridinyl)-5-[3-methoxy-5-(prop-2-enoylamino)phenyl]pyrrolo[2,3-b]pyridin-1-yl]methyl ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 135238231 |
| Molecular Formula | C26H24N5O6P |
| Molecular Weight | 533.48 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | [3-(2-cyano-4-pyridinyl)-5-[3-methoxy-5-(prop-2-enoylamino)phenyl]pyrrolo[2,3-b]pyridin-1-yl]methyl ethyl hydrogen phosphate |
| SMILES | C=CC(=O)Nc1cc(OC)cc(-c2cnc3c(c2)c(-c2ccnc(C#N)c2)cn3COP(=O)(O)OCC)c1 |
| InChI | InChI=1S/C26H24N5O6P/c1-4-25(32)30-20-9-18(10-22(12-20)35-3)19-11-23-24(17-6-7-28-21(8-17)13-27)15-31(26(23)29-14-19)16-37-38(33,34)36-5-2/h4,6-12,14-15H,1,5,16H2,2-3H3,(H,30,32)(H,33,34) |
| InChIKey | PDAQDOSXLGYFPM-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 148.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.48 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|