C26H26FN5O2 — CID 135238547
(E)-4-(dimethylamino)-N-[3-[3-(2-fluoro-4-pyridinyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-5-methoxyphenyl]-N-methylbut-2-enamide (PubChem CID 135238547) has the molecular formula C26H26FN5O2 and a molecular weight of 459.53 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-N-[3-[3-(2-fluoro-4-pyridinyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-5-methoxyphenyl]-N-methylbut-2-enamide.
| Compound Name | (E)-4-(dimethylamino)-N-[3-[3-(2-fluoro-4-pyridinyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-5-methoxyphenyl]-N-methylbut-2-enamide |
|---|---|
| PubChem CID | 135238547 |
| Molecular Formula | C26H26FN5O2 |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | (E)-4-(dimethylamino)-N-[3-[3-(2-fluoro-4-pyridinyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-5-methoxyphenyl]-N-methylbut-2-enamide |
| SMILES | COc1cc(-c2cnc3[nH]cc(-c4ccnc(F)c4)c3c2)cc(N(C)C(=O)/C=C/CN(C)C)c1 |
| InChI | InChI=1S/C26H26FN5O2/c1-31(2)9-5-6-25(33)32(3)20-10-18(11-21(14-20)34-4)19-12-22-23(16-30-26(22)29-15-19)17-7-8-28-24(27)13-17/h5-8,10-16H,9H2,1-4H3,(H,29,30)/b6-5+ |
| InChIKey | AUVBTGGMFPQCBU-AATRIKPKSA-N |
| XLogP | 4.52 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|