C19H17N5O — CID 11370950
[5-(3-aminophenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-(2,5-dimethylpyrazol-3-yl)methanone (PubChem CID 11370950) has the molecular formula C19H17N5O and a molecular weight of 331.38 g/mol. Its IUPAC name is [5-(3-aminophenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-(2,5-dimethylpyrazol-3-yl)methanone.
| Compound Name | [5-(3-aminophenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-(2,5-dimethylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 11370950 |
| Molecular Formula | C19H17N5O |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | [5-(3-aminophenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-(2,5-dimethylpyrazol-3-yl)methanone |
| SMILES | Cc1cc(C(=O)c2c[nH]c3ncc(-c4cccc(N)c4)cc23)n(C)n1 |
| InChI | InChI=1S/C19H17N5O/c1-11-6-17(24(2)23-11)18(25)16-10-22-19-15(16)8-13(9-21-19)12-4-3-5-14(20)7-12/h3-10H,20H2,1-2H3,(H,21,22) |
| InChIKey | YEZIYPRIAKDYKQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|