C25H18N4O — CID 58086575
(1-but-2-ynylindol-4-yl)-(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone (PubChem CID 58086575) has the molecular formula C25H18N4O and a molecular weight of 390.45 g/mol. Its IUPAC name is (1-but-2-ynylindol-4-yl)-(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone.
| Compound Name | (1-but-2-ynylindol-4-yl)-(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 58086575 |
| Molecular Formula | C25H18N4O |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | (1-but-2-ynylindol-4-yl)-(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
| SMILES | CC#CCn1ccc2c(C(=O)c3c[nH]c4ncc(-c5cccnc5)cc34)cccc21 |
| InChI | InChI=1S/C25H18N4O/c1-2-3-11-29-12-9-19-20(7-4-8-23(19)29)24(30)22-16-28-25-21(22)13-18(15-27-25)17-6-5-10-26-14-17/h4-10,12-16H,11H2,1H3,(H,27,28) |
| InChIKey | RQEMBYHGCIOPRM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|