C21H19N3O3 — CID 67995085
(5,5-dimethoxycyclohexa-1,3-dien-1-yl)-(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone (PubChem CID 67995085) has the molecular formula C21H19N3O3 and a molecular weight of 361.40 g/mol. Its IUPAC name is (5,5-dimethoxycyclohexa-1,3-dien-1-yl)-(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone.
| Compound Name | (5,5-dimethoxycyclohexa-1,3-dien-1-yl)-(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 67995085 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | (5,5-dimethoxycyclohexa-1,3-dien-1-yl)-(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
| SMILES | COC1(OC)C=CC=C(C(=O)c2c[nH]c3ncc(-c4cccnc4)cc23)C1 |
| InChI | InChI=1S/C21H19N3O3/c1-26-21(27-2)7-3-5-14(10-21)19(25)18-13-24-20-17(18)9-16(12-23-20)15-6-4-8-22-11-15/h3-9,11-13H,10H2,1-2H3,(H,23,24) |
| InChIKey | SNJFVBDVUGLSIS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|