C26H25N5O — CID 58086855
N-butyl-4-[(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]indole-1-carboxamide (PubChem CID 58086855) has the molecular formula C26H25N5O and a molecular weight of 423.52 g/mol. Its IUPAC name is N-butyl-4-[(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]indole-1-carboxamide.
| Compound Name | N-butyl-4-[(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]indole-1-carboxamide |
|---|---|
| PubChem CID | 58086855 |
| Molecular Formula | C26H25N5O |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | N-butyl-4-[(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]indole-1-carboxamide |
| SMILES | CCCCNC(=O)n1ccc2c(Cc3c[nH]c4ncc(-c5cccnc5)cc34)cccc21 |
| InChI | InChI=1S/C26H25N5O/c1-2-3-11-28-26(32)31-12-9-22-18(6-4-8-24(22)31)13-21-17-30-25-23(21)14-20(16-29-25)19-7-5-10-27-15-19/h4-10,12,14-17H,2-3,11,13H2,1H3,(H,28,32)(H,29,30) |
| InChIKey | HQSUEGQUOFXBTQ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|