C21H18N4O3S — CID 134809068
CID 134809068 (PubChem CID 134809068) has the molecular formula C21H18N4O3S and a molecular weight of 406.47 g/mol.
| Compound Name | CID 134809068 |
|---|---|
| PubChem CID | 134809068 |
| Molecular Formula | C21H18N4O3S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | — |
| SMILES | C[S+](=O)([O-])c1cccc(NC(=O)Cc2c[nH]c3ncc(-c4cccnc4)cc23)c1 |
| InChI | InChI=1S/C21H18N4O3S/c1-29(27,28)18-6-2-5-17(10-18)25-20(26)9-16-13-24-21-19(16)8-15(12-23-21)14-4-3-7-22-11-14/h2-8,10-13H,9H2,1H3,(H2-,23,24,25,26,27,28) |
| InChIKey | SCBZVVWYGKNFRL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|