C25H28N6O — CID 154501031
4-[[5-(1-amino-3-methyliminoprop-1-en-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methyl]-N-butylindole-1-carboxamide (PubChem CID 154501031) has the molecular formula C25H28N6O and a molecular weight of 428.54 g/mol. Its IUPAC name is 4-[[5-(1-amino-3-methyliminoprop-1-en-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methyl]-N-butylindole-1-carboxamide.
| Compound Name | 4-[[5-(1-amino-3-methyliminoprop-1-en-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methyl]-N-butylindole-1-carboxamide |
|---|---|
| PubChem CID | 154501031 |
| Molecular Formula | C25H28N6O |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 4-[[5-(1-amino-3-methyliminoprop-1-en-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methyl]-N-butylindole-1-carboxamide |
| SMILES | CCCCNC(=O)n1ccc2c(Cc3c[nH]c4ncc(C(=CN)/C=N/C)cc34)cccc21 |
| InChI | InChI=1S/C25H28N6O/c1-3-4-9-28-25(32)31-10-8-21-17(6-5-7-23(21)31)11-19-16-30-24-22(19)12-18(15-29-24)20(13-26)14-27-2/h5-8,10,12-16H,3-4,9,11,26H2,1-2H3,(H,28,32)(H,29,30)/b20-13?,27-14+ |
| InChIKey | IZLUCSXQYKBGRB-JAQSJVPVSA-N |
| XLogP | 4.47 |
| TPSA | 101.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|