C24H18N2O4 — CID 67006154
3-[3-[3-(3-methoxybenzoyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]phenyl]prop-2-enoic acid (PubChem CID 67006154) has the molecular formula C24H18N2O4 and a molecular weight of 398.42 g/mol. Its IUPAC name is 3-[3-[3-(3-methoxybenzoyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[3-(3-methoxybenzoyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 67006154 |
| Molecular Formula | C24H18N2O4 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 3-[3-[3-(3-methoxybenzoyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]phenyl]prop-2-enoic acid |
| SMILES | COc1cccc(C(=O)c2c[nH]c3nccc(-c4cccc(C=CC(=O)O)c4)c23)c1 |
| InChI | InChI=1S/C24H18N2O4/c1-30-18-7-3-6-17(13-18)23(29)20-14-26-24-22(20)19(10-11-25-24)16-5-2-4-15(12-16)8-9-21(27)28/h2-14H,1H3,(H,25,26)(H,27,28) |
| InChIKey | PZUFLUYJFPQXQG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|