C21H16ClN3OS — CID 143384757
(4-chlorophenyl)-[4-[3-(methylsulfanylamino)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone (PubChem CID 143384757) has the molecular formula C21H16ClN3OS and a molecular weight of 393.90 g/mol. Its IUPAC name is (4-chlorophenyl)-[4-[3-(methylsulfanylamino)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone.
| Compound Name | (4-chlorophenyl)-[4-[3-(methylsulfanylamino)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone |
|---|---|
| PubChem CID | 143384757 |
| Molecular Formula | C21H16ClN3OS |
| Molecular Weight | 393.90 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | (4-chlorophenyl)-[4-[3-(methylsulfanylamino)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone |
| SMILES | CSNc1cccc(-c2ccnc3[nH]cc(C(=O)c4ccc(Cl)cc4)c23)c1 |
| InChI | InChI=1S/C21H16ClN3OS/c1-27-25-16-4-2-3-14(11-16)17-9-10-23-21-19(17)18(12-24-21)20(26)13-5-7-15(22)8-6-13/h2-12,25H,1H3,(H,23,24) |
| InChIKey | GCJUPGLYKYZLKQ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.90 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|