C16H13ClN2O — CID 115512719
(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-(4-ethylphenyl)methanone (PubChem CID 115512719) has the molecular formula C16H13ClN2O and a molecular weight of 284.75 g/mol. Its IUPAC name is (4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-(4-ethylphenyl)methanone.
| Compound Name | (4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-(4-ethylphenyl)methanone |
|---|---|
| PubChem CID | 115512719 |
| Molecular Formula | C16H13ClN2O |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | (4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-(4-ethylphenyl)methanone |
| SMILES | CCc1ccc(C(=O)c2c[nH]c3nccc(Cl)c23)cc1 |
| InChI | InChI=1S/C16H13ClN2O/c1-2-10-3-5-11(6-4-10)15(20)12-9-19-16-14(12)13(17)7-8-18-16/h3-9H,2H2,1H3,(H,18,19) |
| InChIKey | XIOWWMKNLHPBQU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |