C14H11ClN4O — CID 115512779
(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-(3,5-diaminophenyl)methanone (PubChem CID 115512779) has the molecular formula C14H11ClN4O and a molecular weight of 286.72 g/mol. Its IUPAC name is (4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-(3,5-diaminophenyl)methanone.
| Compound Name | (4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-(3,5-diaminophenyl)methanone |
|---|---|
| PubChem CID | 115512779 |
| Molecular Formula | C14H11ClN4O |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | (4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-(3,5-diaminophenyl)methanone |
| SMILES | Nc1cc(N)cc(C(=O)c2c[nH]c3nccc(Cl)c23)c1 |
| InChI | InChI=1S/C14H11ClN4O/c15-11-1-2-18-14-12(11)10(6-19-14)13(20)7-3-8(16)5-9(17)4-7/h1-6H,16-17H2,(H,18,19) |
| InChIKey | TWFATDGFEWTMQV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|