C14H8ClF2N3O — CID 115512798
(2-amino-4,5-difluorophenyl)-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone (PubChem CID 115512798) has the molecular formula C14H8ClF2N3O and a molecular weight of 307.69 g/mol. Its IUPAC name is (2-amino-4,5-difluorophenyl)-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone.
| Compound Name | (2-amino-4,5-difluorophenyl)-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 115512798 |
| Molecular Formula | C14H8ClF2N3O |
| Molecular Weight | 307.69 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | (2-amino-4,5-difluorophenyl)-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
| SMILES | Nc1cc(F)c(F)cc1C(=O)c1c[nH]c2nccc(Cl)c12 |
| InChI | InChI=1S/C14H8ClF2N3O/c15-8-1-2-19-14-12(8)7(5-20-14)13(21)6-3-9(16)10(17)4-11(6)18/h1-5H,18H2,(H,19,20) |
| InChIKey | QHFUBSJOAPCQMG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.69 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|