C14H8ClF2N3O — CID 107123749
(3-amino-2,5-difluorophenyl)-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone (PubChem CID 107123749) has the molecular formula C14H8ClF2N3O and a molecular weight of 307.69 g/mol. Its IUPAC name is (3-amino-2,5-difluorophenyl)-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone.
| Compound Name | (3-amino-2,5-difluorophenyl)-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 107123749 |
| Molecular Formula | C14H8ClF2N3O |
| Molecular Weight | 307.69 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | (3-amino-2,5-difluorophenyl)-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
| SMILES | Nc1cc(F)cc(C(=O)c2c[nH]c3nccc(Cl)c23)c1F |
| InChI | InChI=1S/C14H8ClF2N3O/c15-9-1-2-19-14-11(9)8(5-20-14)13(21)7-3-6(16)4-10(18)12(7)17/h1-5H,18H2,(H,19,20) |
| InChIKey | ZDLZGHNAESKCCP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.69 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|