C20H18N4O3 — CID 69271811
(E)-3-[3-[5-amino-6-(4-methoxyanilino)pyrazin-2-yl]phenyl]prop-2-enoic acid (PubChem CID 69271811) has the molecular formula C20H18N4O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is (E)-3-[3-[5-amino-6-(4-methoxyanilino)pyrazin-2-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[5-amino-6-(4-methoxyanilino)pyrazin-2-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 69271811 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | (E)-3-[3-[5-amino-6-(4-methoxyanilino)pyrazin-2-yl]phenyl]prop-2-enoic acid |
| SMILES | COc1ccc(Nc2nc(-c3cccc(/C=C/C(=O)O)c3)cnc2N)cc1 |
| InChI | InChI=1S/C20H18N4O3/c1-27-16-8-6-15(7-9-16)23-20-19(21)22-12-17(24-20)14-4-2-3-13(11-14)5-10-18(25)26/h2-12H,1H3,(H2,21,22)(H,23,24)(H,25,26)/b10-5+ |
| InChIKey | DUVGNZBAUHSNJR-BJMVGYQFSA-N |
| XLogP | 3.58 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|