C15H14N4O3 — CID 24811688
(E)-3-[3-[6-[(2-amino-2-oxoethyl)amino]pyrazin-2-yl]phenyl]prop-2-enoic acid (PubChem CID 24811688) has the molecular formula C15H14N4O3 and a molecular weight of 298.30 g/mol. Its IUPAC name is (E)-3-[3-[6-[(2-amino-2-oxoethyl)amino]pyrazin-2-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[6-[(2-amino-2-oxoethyl)amino]pyrazin-2-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 24811688 |
| Molecular Formula | C15H14N4O3 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | (E)-3-[3-[6-[(2-amino-2-oxoethyl)amino]pyrazin-2-yl]phenyl]prop-2-enoic acid |
| SMILES | NC(=O)CNc1cncc(-c2cccc(/C=C/C(=O)O)c2)n1 |
| InChI | InChI=1S/C15H14N4O3/c16-13(20)8-18-14-9-17-7-12(19-14)11-3-1-2-10(6-11)4-5-15(21)22/h1-7,9H,8H2,(H2,16,20)(H,18,19)(H,21,22)/b5-4+ |
| InChIKey | CUQLUKUWWVPRAV-SNAWJCMRSA-N |
| XLogP | 1.14 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|