C19H21N3O2 — CID 143631250
(E)-3-[3-[6-(cyclohexylamino)pyrazin-2-yl]phenyl]prop-2-enoic acid (PubChem CID 143631250) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is (E)-3-[3-[6-(cyclohexylamino)pyrazin-2-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[6-(cyclohexylamino)pyrazin-2-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 143631250 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | (E)-3-[3-[6-(cyclohexylamino)pyrazin-2-yl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccc(-c2cncc(NC3CCCCC3)n2)c1 |
| InChI | InChI=1S/C19H21N3O2/c23-19(24)10-9-14-5-4-6-15(11-14)17-12-20-13-18(22-17)21-16-7-2-1-3-8-16/h4-6,9-13,16H,1-3,7-8H2,(H,21,22)(H,23,24)/b10-9+ |
| InChIKey | DPPXKGHCUHMJQI-MDZDMXLPSA-N |
| XLogP | 3.99 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|