C20H24N4O2 — CID 67319944
3-[3-[6-[4-(dimethylamino)piperidin-1-yl]pyrazin-2-yl]phenyl]prop-2-enoic acid (PubChem CID 67319944) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 3-[3-[6-[4-(dimethylamino)piperidin-1-yl]pyrazin-2-yl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[6-[4-(dimethylamino)piperidin-1-yl]pyrazin-2-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 67319944 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 3-[3-[6-[4-(dimethylamino)piperidin-1-yl]pyrazin-2-yl]phenyl]prop-2-enoic acid |
| SMILES | CN(C)C1CCN(c2cncc(-c3cccc(C=CC(=O)O)c3)n2)CC1 |
| InChI | InChI=1S/C20H24N4O2/c1-23(2)17-8-10-24(11-9-17)19-14-21-13-18(22-19)16-5-3-4-15(12-16)6-7-20(25)26/h3-7,12-14,17H,8-11H2,1-2H3,(H,25,26) |
| InChIKey | DMFJKEIAJYYURF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|