C17H16N6 — CID 122421484
methyl-[1-(3-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)azetidin-3-yl]cyanamide (PubChem CID 122421484) has the molecular formula C17H16N6 and a molecular weight of 304.36 g/mol. Its IUPAC name is methyl-[1-(3-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)azetidin-3-yl]cyanamide.
| Compound Name | methyl-[1-(3-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)azetidin-3-yl]cyanamide |
|---|---|
| PubChem CID | 122421484 |
| Molecular Formula | C17H16N6 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | methyl-[1-(3-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)azetidin-3-yl]cyanamide |
| SMILES | CN(C#N)C1CN(c2cnc3[nH]cc(-c4cccnc4)c3c2)C1 |
| InChI | InChI=1S/C17H16N6/c1-22(11-18)14-9-23(10-14)13-5-15-16(8-21-17(15)20-7-13)12-3-2-4-19-6-12/h2-8,14H,9-10H2,1H3,(H,20,21) |
| InChIKey | QPFXRKRYZJHZLY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|