C18H19N7 — CID 122421446
methyl-[1-[3-[5-(methylamino)-3-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]azetidin-3-yl]cyanamide (PubChem CID 122421446) has the molecular formula C18H19N7 and a molecular weight of 333.40 g/mol. Its IUPAC name is methyl-[1-[3-[5-(methylamino)-3-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]azetidin-3-yl]cyanamide.
| Compound Name | methyl-[1-[3-[5-(methylamino)-3-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]azetidin-3-yl]cyanamide |
|---|---|
| PubChem CID | 122421446 |
| Molecular Formula | C18H19N7 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | methyl-[1-[3-[5-(methylamino)-3-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]azetidin-3-yl]cyanamide |
| SMILES | CNc1cncc(-c2c[nH]c3ncc(N4CC(N(C)C#N)C4)cc23)c1 |
| InChI | InChI=1S/C18H19N7/c1-20-13-3-12(5-21-6-13)17-8-23-18-16(17)4-14(7-22-18)25-9-15(10-25)24(2)11-19/h3-8,15,20H,9-10H2,1-2H3,(H,22,23) |
| InChIKey | KNLCJZXAOFDCPB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|