C21H23N5O — CID 122421395
N-methyl-N-[(3S)-1-(3-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)piperidin-3-yl]prop-2-enamide (PubChem CID 122421395) has the molecular formula C21H23N5O and a molecular weight of 361.45 g/mol. Its IUPAC name is N-methyl-N-[(3S)-1-(3-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)piperidin-3-yl]prop-2-enamide.
| Compound Name | N-methyl-N-[(3S)-1-(3-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)piperidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 122421395 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | N-methyl-N-[(3S)-1-(3-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)piperidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N(C)[C@H]1CCCN(c2cnc3[nH]cc(-c4ccncc4)c3c2)C1 |
| InChI | InChI=1S/C21H23N5O/c1-3-20(27)25(2)16-5-4-10-26(14-16)17-11-18-19(13-24-21(18)23-12-17)15-6-8-22-9-7-15/h3,6-9,11-13,16H,1,4-5,10,14H2,2H3,(H,23,24)/t16-/m0/s1 |
| InChIKey | ZYLLTQDHWGTPOC-INIZCTEOSA-N |
| XLogP | 3.24 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|