C26H20N2O — CID 59812098
3-(4-methylphenyl)-5-(2-phenoxyphenyl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 59812098) has the molecular formula C26H20N2O and a molecular weight of 376.46 g/mol. Its IUPAC name is 3-(4-methylphenyl)-5-(2-phenoxyphenyl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-(4-methylphenyl)-5-(2-phenoxyphenyl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 59812098 |
| Molecular Formula | C26H20N2O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 3-(4-methylphenyl)-5-(2-phenoxyphenyl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | Cc1ccc(-c2c[nH]c3ncc(-c4ccccc4Oc4ccccc4)cc23)cc1 |
| InChI | InChI=1S/C26H20N2O/c1-18-11-13-19(14-12-18)24-17-28-26-23(24)15-20(16-27-26)22-9-5-6-10-25(22)29-21-7-3-2-4-8-21/h2-17H,1H3,(H,27,28) |
| InChIKey | AQJQRUJEBOECCZ-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |