C13H11ClN4O2S — CID 175782488
[2-chloro-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)-3-pyridinyl]methanesulfonamide (PubChem CID 175782488) has the molecular formula C13H11ClN4O2S and a molecular weight of 322.78 g/mol. Its IUPAC name is [2-chloro-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)-3-pyridinyl]methanesulfonamide.
| Compound Name | [2-chloro-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)-3-pyridinyl]methanesulfonamide |
|---|---|
| PubChem CID | 175782488 |
| Molecular Formula | C13H11ClN4O2S |
| Molecular Weight | 322.78 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | [2-chloro-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)-3-pyridinyl]methanesulfonamide |
| SMILES | NS(=O)(=O)Cc1cc(-c2c[nH]c3ncccc23)cnc1Cl |
| InChI | InChI=1S/C13H11ClN4O2S/c14-12-9(7-21(15,19)20)4-8(5-17-12)11-6-18-13-10(11)2-1-3-16-13/h1-6H,7H2,(H,16,18)(H2,15,19,20) |
| InChIKey | WWOIEXIZTCGONZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.78 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|