C20H18ClN3O2S — CID 141285589
3-[6-chloro-1-[(4-methylsulfonylphenyl)methyl]-2H-pyridin-4-yl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 141285589) has the molecular formula C20H18ClN3O2S and a molecular weight of 399.90 g/mol. Its IUPAC name is 3-[6-chloro-1-[(4-methylsulfonylphenyl)methyl]-2H-pyridin-4-yl]-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-[6-chloro-1-[(4-methylsulfonylphenyl)methyl]-2H-pyridin-4-yl]-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 141285589 |
| Molecular Formula | C20H18ClN3O2S |
| Molecular Weight | 399.90 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 3-[6-chloro-1-[(4-methylsulfonylphenyl)methyl]-2H-pyridin-4-yl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CS(=O)(=O)c1ccc(CN2CC=C(c3c[nH]c4ncccc34)C=C2Cl)cc1 |
| InChI | InChI=1S/C20H18ClN3O2S/c1-27(25,26)16-6-4-14(5-7-16)13-24-10-8-15(11-19(24)21)18-12-23-20-17(18)3-2-9-22-20/h2-9,11-12H,10,13H2,1H3,(H,22,23) |
| InChIKey | VGQDCBJSEWPIRE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.90 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|