C19H15ClN4O — CID 87191761
6-chloro-N-(4-methoxyphenyl)-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine (PubChem CID 87191761) has the molecular formula C19H15ClN4O and a molecular weight of 350.81 g/mol. Its IUPAC name is 6-chloro-N-(4-methoxyphenyl)-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine.
| Compound Name | 6-chloro-N-(4-methoxyphenyl)-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 87191761 |
| Molecular Formula | C19H15ClN4O |
| Molecular Weight | 350.81 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 6-chloro-N-(4-methoxyphenyl)-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine |
| SMILES | COc1ccc(Nc2cc(-c3c[nH]c4ncccc34)cc(Cl)n2)cc1 |
| InChI | InChI=1S/C19H15ClN4O/c1-25-14-6-4-13(5-7-14)23-18-10-12(9-17(20)24-18)16-11-22-19-15(16)3-2-8-21-19/h2-11H,1H3,(H,21,22)(H,23,24) |
| InChIKey | WBSLJXQVPHHIEF-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.81 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|