C17H17ClN4O — CID 87184931
6-chloro-N-(oxolan-2-ylmethyl)-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine (PubChem CID 87184931) has the molecular formula C17H17ClN4O and a molecular weight of 328.80 g/mol. Its IUPAC name is 6-chloro-N-(oxolan-2-ylmethyl)-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine.
| Compound Name | 6-chloro-N-(oxolan-2-ylmethyl)-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 87184931 |
| Molecular Formula | C17H17ClN4O |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 6-chloro-N-(oxolan-2-ylmethyl)-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine |
| SMILES | Clc1cc(-c2c[nH]c3ncccc23)cc(NCC2CCCO2)n1 |
| InChI | InChI=1S/C17H17ClN4O/c18-15-7-11(14-10-21-17-13(14)4-1-5-19-17)8-16(22-15)20-9-12-3-2-6-23-12/h1,4-5,7-8,10,12H,2-3,6,9H2,(H,19,21)(H,20,22) |
| InChIKey | DLQVCAJBZVXHEH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|