C27H33ClN6O — CID 87191852
N-[4-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]-1-cyclopentylazetidine-2-carboxamide (PubChem CID 87191852) has the molecular formula C27H33ClN6O and a molecular weight of 493.06 g/mol. Its IUPAC name is N-[4-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]-1-cyclopentylazetidine-2-carboxamide.
| Compound Name | N-[4-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]-1-cyclopentylazetidine-2-carboxamide |
|---|---|
| PubChem CID | 87191852 |
| Molecular Formula | C27H33ClN6O |
| Molecular Weight | 493.06 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | N-[4-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]-1-cyclopentylazetidine-2-carboxamide |
| SMILES | O=C(NC1CCC(Nc2cc(-c3c[nH]c4ncccc34)cc(Cl)n2)CC1)C1CCN1C1CCCC1 |
| InChI | InChI=1S/C27H33ClN6O/c28-24-14-17(22-16-30-26-21(22)6-3-12-29-26)15-25(33-24)31-18-7-9-19(10-8-18)32-27(35)23-11-13-34(23)20-4-1-2-5-20/h3,6,12,14-16,18-20,23H,1-2,4-5,7-11,13H2,(H,29,30)(H,31,33)(H,32,35) |
| InChIKey | KYEXCCFNASGQMG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.06 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|